| ID | 569 |
|---|---|
| Name | cuprobam |
| CAS | 7076-63-3 |
| IUPAC | tricopper dichloride dimethyldithiocarbamate |
| Inchi | InChI=1S/C3H7NS2.2ClH.3Cu/c1-4(2)3(5)6;;;;;/h1-2H3,(H,5,6);2*1H;;;/q;;;3*+1/p-3 |
| CIPAC | 483300 |
| EPA Code | |
| Formula | C3H6Cl2Cu3NS2 |
| SMILES | |
| Status | Not Available |
| Mode of Action | Broad spectrum, non-systemic, inhibiting fungal spores from entering the host tissues |
|---|---|
| Pesticide Type | Fungicide, Microbiocide, Molluscicide |
| Chemical Group | Dithiocarbamate |
| Classification |
dithiocarbamate fungicides copper fungicides |
| Molecular Weight | 381.76 |
|---|---|
| Physical State | |
| AlogP | |
| H-Bond Donor | |
| H-Bond Acceptor | |
| Surface Area | |
| Polar Surface Area |
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;