| ID | 474 |
|---|---|
| Name | pyrametostrobin |
| CAS | 915410-70-7 |
| IUPAC | |
| Inchi | InChI=1S/C21H23N3O4/c1-15-19(16-10-6-5-7-11-16)22-23(2)20(15)28-14-17-12-8-9-13-18(17)24(27-4)21(25)26-3/h5-13H,14H2,1-4H3 |
| CIPAC | |
| EPA Code | |
| Formula | C21H23N3O4 |
| SMILES | Cc1c(nn(c1OCc2ccccc2N(C(=O)OC)OC)C)c3ccccc3 |
| Status | Not Available |
| Mode of Action | Systemic translaminar and protectant action having additional curative and eradicant properties. Respiration inhibitor (QoL fungicide). |
|---|---|
| Pesticide Type | Fungicide |
| Chemical Group | Carbanilate |
| Classification |
strobilurin fungicides carbanilate fungicides pyrazole fungicides |
| Molecular Weight | 381.43 |
|---|---|
| Physical State | |
| AlogP | 4.42 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Surface Area | 380.69 |
| Polar Surface Area | 65.82 |
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;