penflufen
Identification (Source:EPA,EU)
| ID | 425 |
|---|---|
| Name | penflufen |
| CAS | 494793-67-8 |
| IUPAC | |
| Inchi | InChI=1S/C18H24FN3O/c1-11(2)10-12(3)14-8-6-7-9-15(14)20-18(23)16-13(4)21-22(5)17(16)19/h6-9,11-12H,10H2,1-5H3,(H,20,23) |
| CIPAC | |
| EPA Code | |
| Formula | C18H24FN3O |
| SMILES | O=C(c1c(nn(c1F)C)C)Nc2ccccc2C(C)CC(C)C |
| Status | PENDING |
Classification
| Mode of Action | Not known |
|---|---|
| Pesticide Type | Fungicide |
| Chemical Group | Pyrazole |
| Classification |
anilide fungicides pyrazole fungicides |
Properties (Source:PubChem)
| Molecular Weight | 317.40 |
|---|---|
| Physical State | |
| AlogP | 4.077 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 2 |
| Surface Area | 329.61 |
| Polar Surface Area | 46.92 |
Structure
ChemMapper Search Option (Docunmentation of ChemMapper)
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;