| ID | 194 |
|---|---|
| Name | amiton |
| CAS | 78-53-5 |
| IUPAC | |
| Inchi | InChI=1S/C10H24NO3PS/c1-5-11(6-2)9-10-16-15(12,13-7-3)14-8-4/h5-10H2,1-4H3 |
| CIPAC | |
| EPA Code | 057302 |
| Formula | C10H24NO3PS |
| SMILES | P(SCCN(CC)CC)(OCC)(OCC)=O |
| Status | Not Available |
| Mode of Action | A contact and stomach poison, acetylcholinesterase (AChE) inhibitor. |
|---|---|
| Pesticide Type | Insecticide, Acaricide, Miticide |
| Chemical Group | Organophosphate |
| Classification |
organothiophosphate acaricides aliphatic organothiophosphate insecticides organothiophosphate insecticides |
| Molecular Weight | 269.34 |
|---|---|
| Physical State | |
| AlogP | 1.927 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Surface Area | 287.45 |
| Polar Surface Area | 73.88 |
| Target Name | RScore (About this table) | |
|---|---|---|
| Acetylcholinesterase | 85(1,1,1,5) | Details |
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;