| ID | 150 |
|---|---|
| Name | dinocton |
| CAS | 104078-12-8 |
| IUPAC | reaction mixture of isomeric dinitro(octyl)phenyl methyl carbonates in which “octyl” is a mixture of 1-methylheptyl, 1-ethylhexyl and 1-propylpentyl groups |
| Inchi | |
| CIPAC | |
| EPA Code | |
| Formula | C16H22N2O7 |
| SMILES | O(C(=O)OC([H])([H])[H])c1c(c([H])c(c([H])c1C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])[H])[N+](=O)[O-])[N+](=O)[O-] |
| Status | Not Available |
| Mode of Action | |
|---|---|
| Pesticide Type | |
| Chemical Group | |
| Classification |
dinitrophenol fungicides dinitrophenol acaricides |
| Molecular Weight | 354.35508 |
|---|---|
| Physical State | |
| AlogP | 5.504 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 7 |
| Surface Area | 364.25 |
| Polar Surface Area | 127.17 |
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;