| ID | 809 |
|---|---|
| Name | benzoylprop |
| CAS | 22212-56-2 |
| IUPAC | |
| Inchi | InChI=1S/C16H13Cl2NO3/c1-10(16(21)22)19(12-7-8-13(17)14(18)9-12)15(20)11-5-3-2-4-6-11/h2-10H,1H3,(H,21,22) |
| CIPAC | 229 |
| EPA Code | |
| Formula | C16H13Cl2NO3 |
| SMILES | Clc2ccc(N(C(=O)c1ccccc1)C(C(=O)O)C)cc2Cl |
| Status | Not Approved |
| Mode of Action | Mode of action is unknown and does not fall into traditional classification systems, selective |
|---|---|
| Pesticide Type | Herbicide |
| Chemical Group | Arylalanine |
| Classification |
arylalanine herbicides anilide herbicides |
| Molecular Weight | 338.19 |
|---|---|
| Physical State | |
| AlogP | 4.115 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 3 |
| Surface Area | 311.36 |
| Polar Surface Area | 57.61 |
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;